About 2-fluoro-2-phenylethenol
2-fluoro-2-phenylethenol (PubChem CID 141157476) has the molecular formula C8H7FO
and a molecular weight of 138.14 g/mol. Its IUPAC name is 2-fluoro-2-phenylethenol.
Molecular Properties
| Compound Name | 2-fluoro-2-phenylethenol |
| PubChem CID | 141157476 |
| Molecular Formula | C8H7FO |
| Molecular Weight | 138.14 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | 2-fluoro-2-phenylethenol |
| SMILES | OC=C(F)c1ccccc1 |
| InChI | InChI=1S/C8H7FO/c9-8(6-10)7-4-2-1-3-5-7/h1-6,10H |
| InChIKey | KDJAYVYGGBXRSC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.14 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-2-phenylethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-2-phenylethenol?
The IUPAC name of 2-fluoro-2-phenylethenol (CID 141157476) is 2-fluoro-2-phenylethenol.
What is the SMILES notation for 2-fluoro-2-phenylethenol?
The canonical SMILES for 2-fluoro-2-phenylethenol is OC=C(F)c1ccccc1.
What is the InChIKey of 2-fluoro-2-phenylethenol?
The InChIKey is KDJAYVYGGBXRSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FO/c9-8(6-10)7-4-2-1-3-5-7/h1-6,10H.
What are the key properties of 2-fluoro-2-phenylethenol?
2-fluoro-2-phenylethenol has a molecular weight of 138.14 g/mol, XLogP of 2.51, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2-phenylethenol is sourced from PubChem (CID 141157476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).