About benzoyl fluoride;tetrahydrofluoride
benzoyl fluoride;tetrahydrofluoride (PubChem CID 139728839) has the molecular formula C7H9F5O
and a molecular weight of 204.14 g/mol. Its IUPAC name is benzoyl fluoride;tetrahydrofluoride.
Molecular Properties
| Compound Name | benzoyl fluoride;tetrahydrofluoride |
| PubChem CID | 139728839 |
| Molecular Formula | C7H9F5O |
| Molecular Weight | 204.14 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | benzoyl fluoride;tetrahydrofluoride |
| SMILES | F.F.F.F.O=C(F)c1ccccc1 |
| InChI | InChI=1S/C7H5FO.4FH/c8-7(9)6-4-2-1-3-5-6;;;;/h1-5H;4*1H |
| InChIKey | UVAWJKIKSFHVMD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.14 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze benzoyl fluoride;tetrahydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoyl fluoride;tetrahydrofluoride?
The IUPAC name of benzoyl fluoride;tetrahydrofluoride (CID 139728839) is benzoyl fluoride;tetrahydrofluoride.
What is the SMILES notation for benzoyl fluoride;tetrahydrofluoride?
The canonical SMILES for benzoyl fluoride;tetrahydrofluoride is F.F.F.F.O=C(F)c1ccccc1.
What is the InChIKey of benzoyl fluoride;tetrahydrofluoride?
The InChIKey is UVAWJKIKSFHVMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FO.4FH/c8-7(9)6-4-2-1-3-5-6;;;;/h1-5H;4*1H.
What are the key properties of benzoyl fluoride;tetrahydrofluoride?
benzoyl fluoride;tetrahydrofluoride has a molecular weight of 204.14 g/mol, XLogP of 2.41, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzoyl fluoride;tetrahydrofluoride is sourced from PubChem (CID 139728839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).