C25H23NO5S2 — CID 177451242
N-(benzenesulfonyl)-N-[(2E)-5-methyl-1-oxo-3-phenylhexa-2,4-dien-2-yl]benzenesulfonamide (PubChem CID 177451242) has the molecular formula C25H23NO5S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N-[(2E)-5-methyl-1-oxo-3-phenylhexa-2,4-dien-2-yl]benzenesulfonamide.
| Compound Name | N-(benzenesulfonyl)-N-[(2E)-5-methyl-1-oxo-3-phenylhexa-2,4-dien-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 177451242 |
| Molecular Formula | C25H23NO5S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | N-(benzenesulfonyl)-N-[(2E)-5-methyl-1-oxo-3-phenylhexa-2,4-dien-2-yl]benzenesulfonamide |
| SMILES | CC(C)=C/C(=C(/C=O)N(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H23NO5S2/c1-20(2)18-24(21-12-6-3-7-13-21)25(19-27)26(32(28,29)22-14-8-4-9-15-22)33(30,31)23-16-10-5-11-17-23/h3-19H,1-2H3/b25-24+ |
| InChIKey | CZLBPEYVPNWEQO-OCOZRVBESA-N |
| XLogP | 4.64 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|