About (Z)-4-bromo-3,4-diphenylbut-3-en-2-one
(Z)-4-bromo-3,4-diphenylbut-3-en-2-one (PubChem CID 19389265) has the molecular formula C16H13BrO
and a molecular weight of 301.18 g/mol. Its IUPAC name is (Z)-4-bromo-3,4-diphenylbut-3-en-2-one.
Molecular Properties
| Compound Name | (Z)-4-bromo-3,4-diphenylbut-3-en-2-one |
| PubChem CID | 19389265 |
| Molecular Formula | C16H13BrO |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | (Z)-4-bromo-3,4-diphenylbut-3-en-2-one |
| SMILES | CC(=O)/C(=C(\Br)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H13BrO/c1-12(18)15(13-8-4-2-5-9-13)16(17)14-10-6-3-7-11-14/h2-11H,1H3/b16-15+ |
| InChIKey | KKKLHTVYPZDZED-FOCLMDBBSA-N |
| XLogP | 4.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-bromo-3,4-diphenylbut-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-bromo-3,4-diphenylbut-3-en-2-one?
The IUPAC name of (Z)-4-bromo-3,4-diphenylbut-3-en-2-one (CID 19389265) is (Z)-4-bromo-3,4-diphenylbut-3-en-2-one.
What is the SMILES notation for (Z)-4-bromo-3,4-diphenylbut-3-en-2-one?
The canonical SMILES for (Z)-4-bromo-3,4-diphenylbut-3-en-2-one is CC(=O)/C(=C(\Br)c1ccccc1)c1ccccc1.
What is the InChIKey of (Z)-4-bromo-3,4-diphenylbut-3-en-2-one?
The InChIKey is KKKLHTVYPZDZED-FOCLMDBBSA-N. The full InChI is InChI=1S/C16H13BrO/c1-12(18)15(13-8-4-2-5-9-13)16(17)14-10-6-3-7-11-14/h2-11H,1H3/b16-15+.
What are the key properties of (Z)-4-bromo-3,4-diphenylbut-3-en-2-one?
(Z)-4-bromo-3,4-diphenylbut-3-en-2-one has a molecular weight of 301.18 g/mol, XLogP of 4.54, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-bromo-3,4-diphenylbut-3-en-2-one is sourced from PubChem (CID 19389265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).