C8H3Cl2F3NO3S- — CID 155621507
(1Z)-3,5-dichloro-N-(trifluoromethylsulfonyl)benzenecarboximidate (PubChem CID 155621507) has the molecular formula C8H3Cl2F3NO3S- and a molecular weight of 321.08 g/mol. Its IUPAC name is (1Z)-3,5-dichloro-N-(trifluoromethylsulfonyl)benzenecarboximidate.
| Compound Name | (1Z)-3,5-dichloro-N-(trifluoromethylsulfonyl)benzenecarboximidate |
|---|---|
| PubChem CID | 155621507 |
| Molecular Formula | C8H3Cl2F3NO3S- |
| Molecular Weight | 321.08 g/mol |
| Exact Mass | 319.92 |
| IUPAC Name | (1Z)-3,5-dichloro-N-(trifluoromethylsulfonyl)benzenecarboximidate |
| SMILES | O=S(=O)(/N=C(\[O-])c1cc(Cl)cc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C8H4Cl2F3NO3S/c9-5-1-4(2-6(10)3-5)7(15)14-18(16,17)8(11,12)13/h1-3H,(H,14,15)/p-1 |
| InChIKey | JNPAXUSQYUTOFS-UHFFFAOYSA-M |
| XLogP | 1.95 |
| TPSA | 69.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.08 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|