C8H6F3N2O3S- — CID 155621360
(1Z)-4-amino-N-(trifluoromethylsulfonyl)benzenecarboximidate (PubChem CID 155621360) has the molecular formula C8H6F3N2O3S- and a molecular weight of 267.21 g/mol. Its IUPAC name is (1Z)-4-amino-N-(trifluoromethylsulfonyl)benzenecarboximidate.
| Compound Name | (1Z)-4-amino-N-(trifluoromethylsulfonyl)benzenecarboximidate |
|---|---|
| PubChem CID | 155621360 |
| Molecular Formula | C8H6F3N2O3S- |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | (1Z)-4-amino-N-(trifluoromethylsulfonyl)benzenecarboximidate |
| SMILES | Nc1ccc(/C([O-])=N/S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C8H7F3N2O3S/c9-8(10,11)17(15,16)13-7(14)5-1-3-6(12)4-2-5/h1-4H,12H2,(H,13,14)/p-1 |
| InChIKey | BRJMTPDXXAWYCH-UHFFFAOYSA-M |
| XLogP | 0.23 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|