C7H7F3N2O2S — CID 43602626
N-(4-aminophenyl)-1,1,1-trifluoromethanesulfonamide (PubChem CID 43602626) has the molecular formula C7H7F3N2O2S and a molecular weight of 240.21 g/mol. Its IUPAC name is N-(4-aminophenyl)-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-(4-aminophenyl)-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 43602626 |
| Molecular Formula | C7H7F3N2O2S |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | N-(4-aminophenyl)-1,1,1-trifluoromethanesulfonamide |
| SMILES | Nc1ccc(NS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C7H7F3N2O2S/c8-7(9,10)15(13,14)12-6-3-1-5(11)2-4-6/h1-4,12H,11H2 |
| InChIKey | UJKATHBULMRPFK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|