C6H10N2O4S — CID 27769
benzene-1,4-diamine;sulfuric acid (PubChem CID 27769) has the molecular formula C6H10N2O4S and a molecular weight of 206.22 g/mol. Its IUPAC name is benzene-1,4-diamine;sulfuric acid.
| Compound Name | benzene-1,4-diamine;sulfuric acid |
|---|---|
| PubChem CID | 27769 |
| Molecular Formula | C6H10N2O4S |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | benzene-1,4-diamine;sulfuric acid |
| SMILES | Nc1ccc(N)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C6H8N2.H2O4S/c7-5-1-2-6(8)4-3-5;1-5(2,3)4/h1-4H,7-8H2;(H2,1,2,3,4) |
| InChIKey | UFPKLWVNKAMAPE-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|