C6H9ClN2O4S — CID 22584
2-chlorobenzene-1,4-diamine;sulfuric acid (PubChem CID 22584) has the molecular formula C6H9ClN2O4S and a molecular weight of 240.67 g/mol. Its IUPAC name is 2-chlorobenzene-1,4-diamine;sulfuric acid.
| Compound Name | 2-chlorobenzene-1,4-diamine;sulfuric acid |
|---|---|
| PubChem CID | 22584 |
| Molecular Formula | C6H9ClN2O4S |
| Molecular Weight | 240.67 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | 2-chlorobenzene-1,4-diamine;sulfuric acid |
| SMILES | Nc1ccc(N)c(Cl)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C6H7ClN2.H2O4S/c7-5-3-4(8)1-2-6(5)9;1-5(2,3)4/h1-3H,8-9H2;(H2,1,2,3,4) |
| InChIKey | GQFGHCRXPLROOF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.67 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|