2-chloroaniline;sulfuric acid

C6H8ClNO4S — CID 23148633

IUPAC2-chloroaniline;sulfuric acid
SMILESNc1ccccc1Cl.O=S(=O)(O)O
InChIInChI=1S/C6H6ClN.H2O4S/c7-5-3-1-2-4-6(5)8;1-5(2,3)4/h1-4H,8H2;(H2,1,2,3,4)
InChIKeyYRAJLCZAVRDDRO-UHFFFAOYSA-N
MW225.65 g/mol
LogP1.27
Rot. Bonds

About 2-chloroaniline;sulfuric acid

2-chloroaniline;sulfuric acid (PubChem CID 23148633) has the molecular formula C6H8ClNO4S and a molecular weight of 225.65 g/mol. Its IUPAC name is 2-chloroaniline;sulfuric acid.

Molecular Properties

Compound Name2-chloroaniline;sulfuric acid
PubChem CID23148633
Molecular FormulaC6H8ClNO4S
Molecular Weight225.65 g/mol
Exact Mass224.99
IUPAC Name2-chloroaniline;sulfuric acid
SMILESNc1ccccc1Cl.O=S(=O)(O)O
InChIInChI=1S/C6H6ClN.H2O4S/c7-5-3-1-2-4-6(5)8;1-5(2,3)4/h1-4H,8H2;(H2,1,2,3,4)
InChIKeyYRAJLCZAVRDDRO-UHFFFAOYSA-N
XLogP1.27
TPSA100.62 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.65
LogP ≤ 51.27
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-chloroaniline;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloroaniline;sulfuric acid?
The IUPAC name of 2-chloroaniline;sulfuric acid (CID 23148633) is 2-chloroaniline;sulfuric acid.
What is the SMILES notation for 2-chloroaniline;sulfuric acid?
The canonical SMILES for 2-chloroaniline;sulfuric acid is Nc1ccccc1Cl.O=S(=O)(O)O.
What is the InChIKey of 2-chloroaniline;sulfuric acid?
The InChIKey is YRAJLCZAVRDDRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN.H2O4S/c7-5-3-1-2-4-6(5)8;1-5(2,3)4/h1-4H,8H2;(H2,1,2,3,4).
What are the key properties of 2-chloroaniline;sulfuric acid?
2-chloroaniline;sulfuric acid has a molecular weight of 225.65 g/mol, XLogP of 1.27, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroaniline;sulfuric acid is sourced from PubChem (CID 23148633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).