C8H2F6NO3S- — CID 155621251
(1Z)-2,4,6-trifluoro-N-(trifluoromethylsulfonyl)benzenecarboximidate (PubChem CID 155621251) has the molecular formula C8H2F6NO3S- and a molecular weight of 306.16 g/mol. Its IUPAC name is (1Z)-2,4,6-trifluoro-N-(trifluoromethylsulfonyl)benzenecarboximidate.
| Compound Name | (1Z)-2,4,6-trifluoro-N-(trifluoromethylsulfonyl)benzenecarboximidate |
|---|---|
| PubChem CID | 155621251 |
| Molecular Formula | C8H2F6NO3S- |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | (1Z)-2,4,6-trifluoro-N-(trifluoromethylsulfonyl)benzenecarboximidate |
| SMILES | O=S(=O)(/N=C(\[O-])c1c(F)cc(F)cc1F)C(F)(F)F |
| InChI | InChI=1S/C8H3F6NO3S/c9-3-1-4(10)6(5(11)2-3)7(16)15-19(17,18)8(12,13)14/h1-2H,(H,15,16)/p-1 |
| InChIKey | OZYUXRFXDQOFSZ-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 69.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|