C17H8F8NNaO3S — CID 23667770
sodium (1Z)-N-[(E)-2-(2,4-difluorophenyl)ethenyl]sulfonyl-2,4-bis(trifluoromethyl)benzenecarboximidate (PubChem CID 23667770) has the molecular formula C17H8F8NNaO3S and a molecular weight of 481.30 g/mol. Its IUPAC name is sodium (1Z)-N-[(E)-2-(2,4-difluorophenyl)ethenyl]sulfonyl-2,4-bis(trifluoromethyl)benzenecarboximidate.
| Compound Name | sodium (1Z)-N-[(E)-2-(2,4-difluorophenyl)ethenyl]sulfonyl-2,4-bis(trifluoromethyl)benzenecarboximidate |
|---|---|
| PubChem CID | 23667770 |
| Molecular Formula | C17H8F8NNaO3S |
| Molecular Weight | 481.30 g/mol |
| Exact Mass | 481.00 |
| IUPAC Name | sodium (1Z)-N-[(E)-2-(2,4-difluorophenyl)ethenyl]sulfonyl-2,4-bis(trifluoromethyl)benzenecarboximidate |
| SMILES | O=S(=O)(/C=C/c1ccc(F)cc1F)/N=C(\[O-])c1ccc(C(F)(F)F)cc1C(F)(F)F.[Na+] |
| InChI | InChI=1S/C17H9F8NO3S.Na/c18-11-3-1-9(14(19)8-11)5-6-30(28,29)26-15(27)12-4-2-10(16(20,21)22)7-13(12)17(23,24)25;/h1-8H,(H,26,27);/q;+1/p-1/b6-5+; |
| InChIKey | QUEYSWYECMGLFS-IPZCTEOASA-M |
| XLogP | 1.11 |
| TPSA | 69.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|