C17H10ClFNNaO3S2 — CID 23712566
sodium (1Z)-N-[(E)-2-(1-benzothiophen-3-yl)ethenyl]sulfonyl-2-chloro-4-fluorobenzenecarboximidate (PubChem CID 23712566) has the molecular formula C17H10ClFNNaO3S2 and a molecular weight of 417.85 g/mol. Its IUPAC name is sodium (1Z)-N-[(E)-2-(1-benzothiophen-3-yl)ethenyl]sulfonyl-2-chloro-4-fluorobenzenecarboximidate.
| Compound Name | sodium (1Z)-N-[(E)-2-(1-benzothiophen-3-yl)ethenyl]sulfonyl-2-chloro-4-fluorobenzenecarboximidate |
|---|---|
| PubChem CID | 23712566 |
| Molecular Formula | C17H10ClFNNaO3S2 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 416.97 |
| IUPAC Name | sodium (1Z)-N-[(E)-2-(1-benzothiophen-3-yl)ethenyl]sulfonyl-2-chloro-4-fluorobenzenecarboximidate |
| SMILES | O=S(=O)(/C=C/c1csc2ccccc12)/N=C(\[O-])c1ccc(F)cc1Cl.[Na+] |
| InChI | InChI=1S/C17H11ClFNO3S2.Na/c18-15-9-12(19)5-6-14(15)17(21)20-25(22,23)8-7-11-10-24-16-4-2-1-3-13(11)16;/h1-10H,(H,20,21);/q;+1/p-1/b8-7+; |
| InChIKey | LWTLKZMDDOLFEU-USRGLUTNSA-M |
| XLogP | 0.81 |
| TPSA | 69.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|