C15H9BrClFNNaO3S — CID 23700195
sodium (2-bromo-4-fluorobenzoyl)-[(E)-2-(2-chlorophenyl)ethenyl]sulfonylazanide (PubChem CID 23700195) has the molecular formula C15H9BrClFNNaO3S and a molecular weight of 440.65 g/mol. Its IUPAC name is sodium (2-bromo-4-fluorobenzoyl)-[(E)-2-(2-chlorophenyl)ethenyl]sulfonylazanide.
| Compound Name | sodium (2-bromo-4-fluorobenzoyl)-[(E)-2-(2-chlorophenyl)ethenyl]sulfonylazanide |
|---|---|
| PubChem CID | 23700195 |
| Molecular Formula | C15H9BrClFNNaO3S |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 438.91 |
| IUPAC Name | sodium (2-bromo-4-fluorobenzoyl)-[(E)-2-(2-chlorophenyl)ethenyl]sulfonylazanide |
| SMILES | O=C([N-]S(=O)(=O)/C=C/c1ccccc1Cl)c1ccc(F)cc1Br.[Na+] |
| InChI | InChI=1S/C15H10BrClFNO3S.Na/c16-13-9-11(18)5-6-12(13)15(20)19-23(21,22)8-7-10-3-1-2-4-14(10)17;/h1-9H,(H,19,20);/q;+1/p-1/b8-7+; |
| InChIKey | VSIZAUODOQIYHR-USRGLUTNSA-M |
| XLogP | 1.76 |
| TPSA | 65.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |