C15H12BrN2NaO3S — CID 23703219
sodium (2-bromo-4-methylbenzoyl)-[(E)-2-pyridin-2-ylethenyl]sulfonylazanide (PubChem CID 23703219) has the molecular formula C15H12BrN2NaO3S and a molecular weight of 403.23 g/mol. Its IUPAC name is sodium (2-bromo-4-methylbenzoyl)-[(E)-2-pyridin-2-ylethenyl]sulfonylazanide.
| Compound Name | sodium (2-bromo-4-methylbenzoyl)-[(E)-2-pyridin-2-ylethenyl]sulfonylazanide |
|---|---|
| PubChem CID | 23703219 |
| Molecular Formula | C15H12BrN2NaO3S |
| Molecular Weight | 403.23 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | sodium (2-bromo-4-methylbenzoyl)-[(E)-2-pyridin-2-ylethenyl]sulfonylazanide |
| SMILES | Cc1ccc(C(=O)[N-]S(=O)(=O)/C=C/c2ccccn2)c(Br)c1.[Na+] |
| InChI | InChI=1S/C15H13BrN2O3S.Na/c1-11-5-6-13(14(16)10-11)15(19)18-22(20,21)9-7-12-4-2-3-8-17-12;/h2-10H,1H3,(H,18,19);/q;+1/p-1/b9-7+; |
| InChIKey | BRVZYPBBZRWZBI-BXTVWIJMSA-M |
| XLogP | 0.67 |
| TPSA | 78.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.23 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |