C16H15BrClNO4S — CID 87833134
2-bromo-4-methylbenzamide;(E)-2-(2-chlorophenyl)ethenesulfonic acid (PubChem CID 87833134) has the molecular formula C16H15BrClNO4S and a molecular weight of 432.72 g/mol. Its IUPAC name is 2-bromo-4-methylbenzamide;(E)-2-(2-chlorophenyl)ethenesulfonic acid.
| Compound Name | 2-bromo-4-methylbenzamide;(E)-2-(2-chlorophenyl)ethenesulfonic acid |
|---|---|
| PubChem CID | 87833134 |
| Molecular Formula | C16H15BrClNO4S |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 430.96 |
| IUPAC Name | 2-bromo-4-methylbenzamide;(E)-2-(2-chlorophenyl)ethenesulfonic acid |
| SMILES | Cc1ccc(C(N)=O)c(Br)c1.O=S(=O)(O)/C=C/c1ccccc1Cl |
| InChI | InChI=1S/C8H8BrNO.C8H7ClO3S/c1-5-2-3-6(8(10)11)7(9)4-5;9-8-4-2-1-3-7(8)5-6-13(10,11)12/h2-4H,1H3,(H2,10,11);1-6H,(H,10,11,12)/b;6-5+ |
| InChIKey | XQYCFRPVJNIPIE-MXDQRGINSA-N |
| XLogP | 4.05 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|