C15H13BrClNO3S — CID 146252089
[3-bromo-4-(2-chloro-4-methylbenzoyl)phenyl]methanesulfonamide (PubChem CID 146252089) has the molecular formula C15H13BrClNO3S and a molecular weight of 402.70 g/mol. Its IUPAC name is [3-bromo-4-(2-chloro-4-methylbenzoyl)phenyl]methanesulfonamide.
| Compound Name | [3-bromo-4-(2-chloro-4-methylbenzoyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 146252089 |
| Molecular Formula | C15H13BrClNO3S |
| Molecular Weight | 402.70 g/mol |
| Exact Mass | 400.95 |
| IUPAC Name | [3-bromo-4-(2-chloro-4-methylbenzoyl)phenyl]methanesulfonamide |
| SMILES | Cc1ccc(C(=O)c2ccc(CS(N)(=O)=O)cc2Br)c(Cl)c1 |
| InChI | InChI=1S/C15H13BrClNO3S/c1-9-2-4-12(14(17)6-9)15(19)11-5-3-10(7-13(11)16)8-22(18,20)21/h2-7H,8H2,1H3,(H2,18,20,21) |
| InChIKey | JXEIWHZCYHVNLE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.70 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |