C15H12BrCl2NO4S — CID 174549658
4-bromo-2-chlorobenzamide;2-(3-chlorophenyl)ethenesulfonic acid (PubChem CID 174549658) has the molecular formula C15H12BrCl2NO4S and a molecular weight of 453.14 g/mol. Its IUPAC name is 4-bromo-2-chlorobenzamide;2-(3-chlorophenyl)ethenesulfonic acid.
| Compound Name | 4-bromo-2-chlorobenzamide;2-(3-chlorophenyl)ethenesulfonic acid |
|---|---|
| PubChem CID | 174549658 |
| Molecular Formula | C15H12BrCl2NO4S |
| Molecular Weight | 453.14 g/mol |
| Exact Mass | 450.90 |
| IUPAC Name | 4-bromo-2-chlorobenzamide;2-(3-chlorophenyl)ethenesulfonic acid |
| SMILES | NC(=O)c1ccc(Br)cc1Cl.O=S(=O)(O)C=Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C8H7ClO3S.C7H5BrClNO/c9-8-3-1-2-7(6-8)4-5-13(10,11)12;8-4-1-2-5(7(10)11)6(9)3-4/h1-6H,(H,10,11,12);1-3H,(H2,10,11) |
| InChIKey | SIBKLIMQTCPMEW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.14 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|