C16H12ClF4NO5S — CID 174564704
2-chloro-4-fluorobenzamide;2-[4-(trifluoromethoxy)phenyl]ethenesulfonic acid (PubChem CID 174564704) has the molecular formula C16H12ClF4NO5S and a molecular weight of 441.79 g/mol. Its IUPAC name is 2-chloro-4-fluorobenzamide;2-[4-(trifluoromethoxy)phenyl]ethenesulfonic acid.
| Compound Name | 2-chloro-4-fluorobenzamide;2-[4-(trifluoromethoxy)phenyl]ethenesulfonic acid |
|---|---|
| PubChem CID | 174564704 |
| Molecular Formula | C16H12ClF4NO5S |
| Molecular Weight | 441.79 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | 2-chloro-4-fluorobenzamide;2-[4-(trifluoromethoxy)phenyl]ethenesulfonic acid |
| SMILES | NC(=O)c1ccc(F)cc1Cl.O=S(=O)(O)C=Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C9H7F3O4S.C7H5ClFNO/c10-9(11,12)16-8-3-1-7(2-4-8)5-6-17(13,14)15;8-6-3-4(9)1-2-5(6)7(10)11/h1-6H,(H,13,14,15);1-3H,(H2,10,11) |
| InChIKey | NZRQHMLVEXUZNY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.79 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|