About 2,4-dimethylbenzamide;2-[4-(trifluoromethyl)phenyl]ethenesulfonic acid
2,4-dimethylbenzamide;2-[4-(trifluoromethyl)phenyl]ethenesulfonic acid (PubChem CID 174549666) has the molecular formula C18H18F3NO4S
and a molecular weight of 401.41 g/mol. Its IUPAC name is 2,4-dimethylbenzamide;2-[4-(trifluoromethyl)phenyl]ethenesulfonic acid.
Molecular Properties
| Compound Name | 2,4-dimethylbenzamide;2-[4-(trifluoromethyl)phenyl]ethenesulfonic acid |
| PubChem CID | 174549666 |
| Molecular Formula | C18H18F3NO4S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 2,4-dimethylbenzamide;2-[4-(trifluoromethyl)phenyl]ethenesulfonic acid |
| SMILES | Cc1ccc(C(N)=O)c(C)c1.O=S(=O)(O)C=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H7F3O3S.C9H11NO/c10-9(11,12)8-3-1-7(2-4-8)5-6-16(13,14)15;1-6-3-4-8(9(10)11)7(2)5-6/h1-6H,(H,13,14,15);3-5H,1-2H3,(H2,10,11) |
| InChIKey | VKSARLPROLYRDB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethylbenzamide;2-[4-(trifluoromethyl)phenyl]ethenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylbenzamide;2-[4-(trifluoromethyl)phenyl]ethenesulfonic acid?
The IUPAC name of 2,4-dimethylbenzamide;2-[4-(trifluoromethyl)phenyl]ethenesulfonic acid (CID 174549666) is 2,4-dimethylbenzamide;2-[4-(trifluoromethyl)phenyl]ethenesulfonic acid.
What is the SMILES notation for 2,4-dimethylbenzamide;2-[4-(trifluoromethyl)phenyl]ethenesulfonic acid?
The canonical SMILES for 2,4-dimethylbenzamide;2-[4-(trifluoromethyl)phenyl]ethenesulfonic acid is Cc1ccc(C(N)=O)c(C)c1.O=S(=O)(O)C=Cc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2,4-dimethylbenzamide;2-[4-(trifluoromethyl)phenyl]ethenesulfonic acid?
The InChIKey is VKSARLPROLYRDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3O3S.C9H11NO/c10-9(11,12)8-3-1-7(2-4-8)5-6-16(13,14)15;1-6-3-4-8(9(10)11)7(2)5-6/h1-6H,(H,13,14,15);3-5H,1-2H3,(H2,10,11).
What are the key properties of 2,4-dimethylbenzamide;2-[4-(trifluoromethyl)phenyl]ethenesulfonic acid?
2,4-dimethylbenzamide;2-[4-(trifluoromethyl)phenyl]ethenesulfonic acid has a molecular weight of 401.41 g/mol, XLogP of 3.97, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylbenzamide;2-[4-(trifluoromethyl)phenyl]ethenesulfonic acid is sourced from PubChem (CID 174549666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).