C14H12BrClN2O4S — CID 87641690
4-bromo-2-chlorobenzamide;(E)-2-pyridin-3-ylethenesulfonic acid (PubChem CID 87641690) has the molecular formula C14H12BrClN2O4S and a molecular weight of 419.68 g/mol. Its IUPAC name is 4-bromo-2-chlorobenzamide;(E)-2-pyridin-3-ylethenesulfonic acid.
| Compound Name | 4-bromo-2-chlorobenzamide;(E)-2-pyridin-3-ylethenesulfonic acid |
|---|---|
| PubChem CID | 87641690 |
| Molecular Formula | C14H12BrClN2O4S |
| Molecular Weight | 419.68 g/mol |
| Exact Mass | 417.94 |
| IUPAC Name | 4-bromo-2-chlorobenzamide;(E)-2-pyridin-3-ylethenesulfonic acid |
| SMILES | NC(=O)c1ccc(Br)cc1Cl.O=S(=O)(O)/C=C/c1cccnc1 |
| InChI | InChI=1S/C7H5BrClNO.C7H7NO3S/c8-4-1-2-5(7(10)11)6(9)3-4;9-12(10,11)5-3-7-2-1-4-8-6-7/h1-3H,(H2,10,11);1-6H,(H,9,10,11)/b;5-3+ |
| InChIKey | GMVPEUHSMSVHFQ-GWDXERMASA-N |
| XLogP | 3.14 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.68 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|