C16H15Cl2NO5S — CID 87831497
4-chloro-2-methoxybenzamide;(E)-2-(3-chlorophenyl)ethenesulfonic acid (PubChem CID 87831497) has the molecular formula C16H15Cl2NO5S and a molecular weight of 404.27 g/mol. Its IUPAC name is 4-chloro-2-methoxybenzamide;(E)-2-(3-chlorophenyl)ethenesulfonic acid.
| Compound Name | 4-chloro-2-methoxybenzamide;(E)-2-(3-chlorophenyl)ethenesulfonic acid |
|---|---|
| PubChem CID | 87831497 |
| Molecular Formula | C16H15Cl2NO5S |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 4-chloro-2-methoxybenzamide;(E)-2-(3-chlorophenyl)ethenesulfonic acid |
| SMILES | COc1cc(Cl)ccc1C(N)=O.O=S(=O)(O)/C=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C8H8ClNO2.C8H7ClO3S/c1-12-7-4-5(9)2-3-6(7)8(10)11;9-8-3-1-2-7(6-8)4-5-13(10,11)12/h2-4H,1H3,(H2,10,11);1-6H,(H,10,11,12)/b;5-4+ |
| InChIKey | XUYYYJZTPPOBII-RCKHEGBHSA-N |
| XLogP | 3.65 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|