C10H9F3O3S — CID 114969576
3-methylsulfonyl-1-(2,4,6-trifluorophenyl)propan-1-one (PubChem CID 114969576) has the molecular formula C10H9F3O3S and a molecular weight of 266.24 g/mol. Its IUPAC name is 3-methylsulfonyl-1-(2,4,6-trifluorophenyl)propan-1-one.
| Compound Name | 3-methylsulfonyl-1-(2,4,6-trifluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 114969576 |
| Molecular Formula | C10H9F3O3S |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 3-methylsulfonyl-1-(2,4,6-trifluorophenyl)propan-1-one |
| SMILES | CS(=O)(=O)CCC(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C10H9F3O3S/c1-17(15,16)3-2-9(14)10-7(12)4-6(11)5-8(10)13/h4-5H,2-3H2,1H3 |
| InChIKey | QXUKOKUIMPYFGF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |