C9H7ClF2O2 — CID 163196629
3-chloro-1-(2,4-difluoro-6-hydroxyphenyl)propan-1-one (PubChem CID 163196629) has the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. Its IUPAC name is 3-chloro-1-(2,4-difluoro-6-hydroxyphenyl)propan-1-one.
| Compound Name | 3-chloro-1-(2,4-difluoro-6-hydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 163196629 |
| Molecular Formula | C9H7ClF2O2 |
| Molecular Weight | 220.60 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 3-chloro-1-(2,4-difluoro-6-hydroxyphenyl)propan-1-one |
| SMILES | O=C(CCCl)c1c(O)cc(F)cc1F |
| InChI | InChI=1S/C9H7ClF2O2/c10-2-1-7(13)9-6(12)3-5(11)4-8(9)14/h3-4,14H,1-2H2 |
| InChIKey | MCNJQDFDFJPEEL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.60 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|