C11H17F6N3O2 — CID 87770884
3-amino-6-[(3-amino-5,5,5-trifluoro-4-oxopentyl)amino]-1,1,1-trifluorohexan-2-one (PubChem CID 87770884) has the molecular formula C11H17F6N3O2 and a molecular weight of 337.26 g/mol. Its IUPAC name is 3-amino-6-[(3-amino-5,5,5-trifluoro-4-oxopentyl)amino]-1,1,1-trifluorohexan-2-one.
| Compound Name | 3-amino-6-[(3-amino-5,5,5-trifluoro-4-oxopentyl)amino]-1,1,1-trifluorohexan-2-one |
|---|---|
| PubChem CID | 87770884 |
| Molecular Formula | C11H17F6N3O2 |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 3-amino-6-[(3-amino-5,5,5-trifluoro-4-oxopentyl)amino]-1,1,1-trifluorohexan-2-one |
| SMILES | NC(CCCNCCC(N)C(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C11H17F6N3O2/c12-10(13,14)8(21)6(18)2-1-4-20-5-3-7(19)9(22)11(15,16)17/h6-7,20H,1-5,18-19H2 |
| InChIKey | XTAFHDRNTSQOQA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|