C14H31N5O2 — CID 57296683
1,3-diamino-8-[(4,6-diamino-5-oxohexyl)amino]octan-2-one (PubChem CID 57296683) has the molecular formula C14H31N5O2 and a molecular weight of 301.44 g/mol. Its IUPAC name is 1,3-diamino-8-[(4,6-diamino-5-oxohexyl)amino]octan-2-one.
| Compound Name | 1,3-diamino-8-[(4,6-diamino-5-oxohexyl)amino]octan-2-one |
|---|---|
| PubChem CID | 57296683 |
| Molecular Formula | C14H31N5O2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.25 |
| IUPAC Name | 1,3-diamino-8-[(4,6-diamino-5-oxohexyl)amino]octan-2-one |
| SMILES | NCC(=O)C(N)CCCCCNCCCC(N)C(=O)CN |
| InChI | InChI=1S/C14H31N5O2/c15-9-13(20)11(17)5-2-1-3-7-19-8-4-6-12(18)14(21)10-16/h11-12,19H,1-10,15-18H2 |
| InChIKey | YUIQSGNGNYGYQO-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 150.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|