C10H21N3O5 — CID 22794530
acetic acid;(2S)-2,6,8-triamino-7-oxooctanoic acid (PubChem CID 22794530) has the molecular formula C10H21N3O5 and a molecular weight of 263.29 g/mol. Its IUPAC name is acetic acid;(2S)-2,6,8-triamino-7-oxooctanoic acid.
| Compound Name | acetic acid;(2S)-2,6,8-triamino-7-oxooctanoic acid |
|---|---|
| PubChem CID | 22794530 |
| Molecular Formula | C10H21N3O5 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | acetic acid;(2S)-2,6,8-triamino-7-oxooctanoic acid |
| SMILES | CC(=O)O.NCC(=O)C(N)CCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H17N3O3.C2H4O2/c9-4-7(12)5(10)2-1-3-6(11)8(13)14;1-2(3)4/h5-6H,1-4,9-11H2,(H,13,14);1H3,(H,3,4)/t5?,6-;/m0./s1 |
| InChIKey | NBLWAGYMZIDBNJ-PQAGPIFVSA-N |
| XLogP | -1.49 |
| TPSA | 169.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |