C15H19F13OS — CID 162582866
1-[7,8,8,8-tetrafluoro-3,5,7-tris(trifluoromethyl)octyl]sulfanylbutan-2-ol (PubChem CID 162582866) has the molecular formula C15H19F13OS and a molecular weight of 494.36 g/mol. Its IUPAC name is 1-[7,8,8,8-tetrafluoro-3,5,7-tris(trifluoromethyl)octyl]sulfanylbutan-2-ol.
| Compound Name | 1-[7,8,8,8-tetrafluoro-3,5,7-tris(trifluoromethyl)octyl]sulfanylbutan-2-ol |
|---|---|
| PubChem CID | 162582866 |
| Molecular Formula | C15H19F13OS |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 1-[7,8,8,8-tetrafluoro-3,5,7-tris(trifluoromethyl)octyl]sulfanylbutan-2-ol |
| SMILES | CCC(O)CSCCC(CC(CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H19F13OS/c1-2-10(29)7-30-4-3-8(12(17,18)19)5-9(13(20,21)22)6-11(16,14(23,24)25)15(26,27)28/h8-10,29H,2-7H2,1H3 |
| InChIKey | PBIAJRIWWXLUJB-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|