C12H26O4S — CID 139888298
1-(2,4-dihydroxyhexylsulfanyl)hexane-2,4-diol (PubChem CID 139888298) has the molecular formula C12H26O4S and a molecular weight of 266.40 g/mol. Its IUPAC name is 1-(2,4-dihydroxyhexylsulfanyl)hexane-2,4-diol.
| Compound Name | 1-(2,4-dihydroxyhexylsulfanyl)hexane-2,4-diol |
|---|---|
| PubChem CID | 139888298 |
| Molecular Formula | C12H26O4S |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1-(2,4-dihydroxyhexylsulfanyl)hexane-2,4-diol |
| SMILES | CCC(O)CC(O)CSCC(O)CC(O)CC |
| InChI | InChI=1S/C12H26O4S/c1-3-9(13)5-11(15)7-17-8-12(16)6-10(14)4-2/h9-16H,3-8H2,1-2H3 |
| InChIKey | PVCLAHTZWKRIGA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |