C9H13F3 — CID 90261567
(4R,5E)-7,7,7-trifluoro-4,6-dimethylhepta-1,5-diene (PubChem CID 90261567) has the molecular formula C9H13F3 and a molecular weight of 178.20 g/mol. Its IUPAC name is (4R,5E)-7,7,7-trifluoro-4,6-dimethylhepta-1,5-diene.
| Compound Name | (4R,5E)-7,7,7-trifluoro-4,6-dimethylhepta-1,5-diene |
|---|---|
| PubChem CID | 90261567 |
| Molecular Formula | C9H13F3 |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (4R,5E)-7,7,7-trifluoro-4,6-dimethylhepta-1,5-diene |
| SMILES | C=CC[C@@H](C)/C=C(\C)C(F)(F)F |
| InChI | InChI=1S/C9H13F3/c1-4-5-7(2)6-8(3)9(10,11)12/h4,6-7H,1,5H2,2-3H3/b8-6+/t7-/m1/s1 |
| InChIKey | XQWRWOAMGXFGGI-UQBZRGDZSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|