C14H21F3 — CID 155261834
(2E,4E)-5-ethenyl-1,1,1-trifluoro-2,6,7,7-tetramethylocta-2,4-diene (PubChem CID 155261834) has the molecular formula C14H21F3 and a molecular weight of 246.32 g/mol. Its IUPAC name is (2E,4E)-5-ethenyl-1,1,1-trifluoro-2,6,7,7-tetramethylocta-2,4-diene.
| Compound Name | (2E,4E)-5-ethenyl-1,1,1-trifluoro-2,6,7,7-tetramethylocta-2,4-diene |
|---|---|
| PubChem CID | 155261834 |
| Molecular Formula | C14H21F3 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (2E,4E)-5-ethenyl-1,1,1-trifluoro-2,6,7,7-tetramethylocta-2,4-diene |
| SMILES | C=C/C(=C\C=C(/C)C(F)(F)F)C(C)C(C)(C)C |
| InChI | InChI=1S/C14H21F3/c1-7-12(11(3)13(4,5)6)9-8-10(2)14(15,16)17/h7-9,11H,1H2,2-6H3/b10-8+,12-9+ |
| InChIKey | CQHOYOSWKPCPGY-AXDLQRQNSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|