C20H30O — CID 142208267
(2Z)-6-ethenyl-7,8,8-trimethylnona-2,5-diene;phenol (PubChem CID 142208267) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (2Z)-6-ethenyl-7,8,8-trimethylnona-2,5-diene;phenol.
| Compound Name | (2Z)-6-ethenyl-7,8,8-trimethylnona-2,5-diene;phenol |
|---|---|
| PubChem CID | 142208267 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (2Z)-6-ethenyl-7,8,8-trimethylnona-2,5-diene;phenol |
| SMILES | C=CC(=CC/C=C\C)C(C)C(C)(C)C.Oc1ccccc1 |
| InChI | InChI=1S/C14H24.C6H6O/c1-7-9-10-11-13(8-2)12(3)14(4,5)6;7-6-4-2-1-3-5-6/h7-9,11-12H,2,10H2,1,3-6H3;1-5,7H/b9-7-,13-11?; |
| InChIKey | ZWVSOYJLFWTGON-KDMAAHLJSA-N |
| XLogP | 6.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|