C11H24 — CID 145347239
ethane;(3S)-2,3,4,4-tetramethylpent-1-ene (PubChem CID 145347239) has the molecular formula C11H24 and a molecular weight of 156.31 g/mol. Its IUPAC name is ethane;(3S)-2,3,4,4-tetramethylpent-1-ene.
| Compound Name | ethane;(3S)-2,3,4,4-tetramethylpent-1-ene |
|---|---|
| PubChem CID | 145347239 |
| Molecular Formula | C11H24 |
| Molecular Weight | 156.31 g/mol |
| Exact Mass | 156.19 |
| IUPAC Name | ethane;(3S)-2,3,4,4-tetramethylpent-1-ene |
| SMILES | C=C(C)[C@@H](C)C(C)(C)C.CC |
| InChI | InChI=1S/C9H18.C2H6/c1-7(2)8(3)9(4,5)6;1-2/h8H,1H2,2-6H3;1-2H3/t8-;/m1./s1 |
| InChIKey | QBUQBVKXDHJXAO-DDWIOCJRSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|