C17H37N — CID 142406278
N-(3,3-dimethylbut-1-en-2-yl)-2,4-dimethylpent-1-en-3-amine;ethane (PubChem CID 142406278) has the molecular formula C17H37N and a molecular weight of 255.49 g/mol. Its IUPAC name is N-(3,3-dimethylbut-1-en-2-yl)-2,4-dimethylpent-1-en-3-amine;ethane.
| Compound Name | N-(3,3-dimethylbut-1-en-2-yl)-2,4-dimethylpent-1-en-3-amine;ethane |
|---|---|
| PubChem CID | 142406278 |
| Molecular Formula | C17H37N |
| Molecular Weight | 255.49 g/mol |
| Exact Mass | 255.29 |
| IUPAC Name | N-(3,3-dimethylbut-1-en-2-yl)-2,4-dimethylpent-1-en-3-amine;ethane |
| SMILES | C=C(C)C(NC(=C)C(C)(C)C)C(C)C.CC.CC |
| InChI | InChI=1S/C13H25N.2C2H6/c1-9(2)12(10(3)4)14-11(5)13(6,7)8;2*1-2/h10,12,14H,1,5H2,2-4,6-8H3;2*1-2H3 |
| InChIKey | UUGSLBRPFIDEJB-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|