C12H24O — CID 124933373
(2R,3S,5R)-3,5,6,6-tetramethyl-4-methylideneheptan-2-ol (PubChem CID 124933373) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is (2R,3S,5R)-3,5,6,6-tetramethyl-4-methylideneheptan-2-ol.
| Compound Name | (2R,3S,5R)-3,5,6,6-tetramethyl-4-methylideneheptan-2-ol |
|---|---|
| PubChem CID | 124933373 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | (2R,3S,5R)-3,5,6,6-tetramethyl-4-methylideneheptan-2-ol |
| SMILES | C=C([C@H](C)[C@@H](C)O)[C@H](C)C(C)(C)C |
| InChI | InChI=1S/C12H24O/c1-8(9(2)11(4)13)10(3)12(5,6)7/h9-11,13H,1H2,2-7H3/t9-,10-,11+/m0/s1 |
| InChIKey | KQHNSYOQXVRMSX-GARJFASQSA-N |
| XLogP | 3.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|