C15H27FN2 — CID 143387135
[1-[(2E)-2,4-dimethylhepta-2,6-dienyl]-4-fluoropiperidin-4-yl]methanamine (PubChem CID 143387135) has the molecular formula C15H27FN2 and a molecular weight of 254.39 g/mol. Its IUPAC name is [1-[(2E)-2,4-dimethylhepta-2,6-dienyl]-4-fluoropiperidin-4-yl]methanamine.
| Compound Name | [1-[(2E)-2,4-dimethylhepta-2,6-dienyl]-4-fluoropiperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 143387135 |
| Molecular Formula | C15H27FN2 |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | [1-[(2E)-2,4-dimethylhepta-2,6-dienyl]-4-fluoropiperidin-4-yl]methanamine |
| SMILES | C=CCC(C)/C=C(\C)CN1CCC(F)(CN)CC1 |
| InChI | InChI=1S/C15H27FN2/c1-4-5-13(2)10-14(3)11-18-8-6-15(16,12-17)7-9-18/h4,10,13H,1,5-9,11-12,17H2,2-3H3/b14-10+ |
| InChIKey | KJJCDLZSHIXQCO-GXDHUFHOSA-N |
| XLogP | 2.91 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|