C18H33FN2 — CID 123501782
2-[2-(4-ethyl-4-fluoropiperidin-1-yl)propyl]-4,5-dimethylhexa-2,4-dien-1-amine (PubChem CID 123501782) has the molecular formula C18H33FN2 and a molecular weight of 296.47 g/mol. Its IUPAC name is 2-[2-(4-ethyl-4-fluoropiperidin-1-yl)propyl]-4,5-dimethylhexa-2,4-dien-1-amine.
| Compound Name | 2-[2-(4-ethyl-4-fluoropiperidin-1-yl)propyl]-4,5-dimethylhexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 123501782 |
| Molecular Formula | C18H33FN2 |
| Molecular Weight | 296.47 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | 2-[2-(4-ethyl-4-fluoropiperidin-1-yl)propyl]-4,5-dimethylhexa-2,4-dien-1-amine |
| SMILES | CCC1(F)CCN(C(C)CC(=CC(C)=C(C)C)CN)CC1 |
| InChI | InChI=1S/C18H33FN2/c1-6-18(19)7-9-21(10-8-18)16(5)12-17(13-20)11-15(4)14(2)3/h11,16H,6-10,12-13,20H2,1-5H3 |
| InChIKey | FWQMYSUNRNGWMX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|