C17H31FN2 — CID 145297020
N-[[1-[(4E)-6-fluoro-2,4-dimethylhepta-4,6-dien-2-yl]piperidin-4-yl]methyl]ethanamine (PubChem CID 145297020) has the molecular formula C17H31FN2 and a molecular weight of 282.45 g/mol. Its IUPAC name is N-[[1-[(4E)-6-fluoro-2,4-dimethylhepta-4,6-dien-2-yl]piperidin-4-yl]methyl]ethanamine.
| Compound Name | N-[[1-[(4E)-6-fluoro-2,4-dimethylhepta-4,6-dien-2-yl]piperidin-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 145297020 |
| Molecular Formula | C17H31FN2 |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.25 |
| IUPAC Name | N-[[1-[(4E)-6-fluoro-2,4-dimethylhepta-4,6-dien-2-yl]piperidin-4-yl]methyl]ethanamine |
| SMILES | C=C(F)/C=C(\C)CC(C)(C)N1CCC(CNCC)CC1 |
| InChI | InChI=1S/C17H31FN2/c1-6-19-13-16-7-9-20(10-8-16)17(4,5)12-14(2)11-15(3)18/h11,16,19H,3,6-10,12-13H2,1-2,4-5H3/b14-11+ |
| InChIKey | ANYHLRDKCHVWMQ-SDNWHVSQSA-N |
| XLogP | 3.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|