C12H21N — CID 123195262
N,N,6-trimethylnona-2,4,8-trien-2-amine (PubChem CID 123195262) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is N,N,6-trimethylnona-2,4,8-trien-2-amine.
| Compound Name | N,N,6-trimethylnona-2,4,8-trien-2-amine |
|---|---|
| PubChem CID | 123195262 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | N,N,6-trimethylnona-2,4,8-trien-2-amine |
| SMILES | C=CCC(C)C=CC=C(C)N(C)C |
| InChI | InChI=1S/C12H21N/c1-6-8-11(2)9-7-10-12(3)13(4)5/h6-7,9-11H,1,8H2,2-5H3 |
| InChIKey | HQXWVHOLRKBAFM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|