C14H22N2O — CID 170184127
N-[(3Z,5E)-6-[ethenyl(methyl)amino]hepta-3,5-dien-2-yl]-N-methylprop-2-enamide (PubChem CID 170184127) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is N-[(3Z,5E)-6-[ethenyl(methyl)amino]hepta-3,5-dien-2-yl]-N-methylprop-2-enamide.
| Compound Name | N-[(3Z,5E)-6-[ethenyl(methyl)amino]hepta-3,5-dien-2-yl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 170184127 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | N-[(3Z,5E)-6-[ethenyl(methyl)amino]hepta-3,5-dien-2-yl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)C(C)/C=C\C=C(/C)N(C)C=C |
| InChI | InChI=1S/C14H22N2O/c1-7-14(17)16(6)13(4)11-9-10-12(3)15(5)8-2/h7-11,13H,1-2H2,3-6H3/b11-9-,12-10+ |
| InChIKey | TVHVNLKWKRCFFU-DSOJMZEYSA-N |
| XLogP | 2.55 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|