About N-[(E,3R)-3-[acetyl(methyl)amino]but-1-enyl]-N-methylacetamide
N-[(E,3R)-3-[acetyl(methyl)amino]but-1-enyl]-N-methylacetamide (PubChem CID 125476538) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is N-[(E,3R)-3-[acetyl(methyl)amino]but-1-enyl]-N-methylacetamide.
Molecular Properties
| Compound Name | N-[(E,3R)-3-[acetyl(methyl)amino]but-1-enyl]-N-methylacetamide |
| PubChem CID | 125476538 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | N-[(E,3R)-3-[acetyl(methyl)amino]but-1-enyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)/C=C/[C@@H](C)N(C)C(C)=O |
| InChI | InChI=1S/C10H18N2O2/c1-8(12(5)10(3)14)6-7-11(4)9(2)13/h6-8H,1-5H3/b7-6+/t8-/m1/s1 |
| InChIKey | BBJNLKLDUJSDAA-HYDMIIDASA-N |
| XLogP | 0.85 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(E,3R)-3-[acetyl(methyl)amino]but-1-enyl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E,3R)-3-[acetyl(methyl)amino]but-1-enyl]-N-methylacetamide?
The IUPAC name of N-[(E,3R)-3-[acetyl(methyl)amino]but-1-enyl]-N-methylacetamide (CID 125476538) is N-[(E,3R)-3-[acetyl(methyl)amino]but-1-enyl]-N-methylacetamide.
What is the SMILES notation for N-[(E,3R)-3-[acetyl(methyl)amino]but-1-enyl]-N-methylacetamide?
The canonical SMILES for N-[(E,3R)-3-[acetyl(methyl)amino]but-1-enyl]-N-methylacetamide is CC(=O)N(C)/C=C/[C@@H](C)N(C)C(C)=O.
What is the InChIKey of N-[(E,3R)-3-[acetyl(methyl)amino]but-1-enyl]-N-methylacetamide?
The InChIKey is BBJNLKLDUJSDAA-HYDMIIDASA-N. The full InChI is InChI=1S/C10H18N2O2/c1-8(12(5)10(3)14)6-7-11(4)9(2)13/h6-8H,1-5H3/b7-6+/t8-/m1/s1.
What are the key properties of N-[(E,3R)-3-[acetyl(methyl)amino]but-1-enyl]-N-methylacetamide?
N-[(E,3R)-3-[acetyl(methyl)amino]but-1-enyl]-N-methylacetamide has a molecular weight of 198.27 g/mol, XLogP of 0.85, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E,3R)-3-[acetyl(methyl)amino]but-1-enyl]-N-methylacetamide is sourced from PubChem (CID 125476538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).