C9H17NO — CID 177234095
N-[(E)-2,3-dimethylbut-1-enyl]-N-methylacetamide (PubChem CID 177234095) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is N-[(E)-2,3-dimethylbut-1-enyl]-N-methylacetamide.
| Compound Name | N-[(E)-2,3-dimethylbut-1-enyl]-N-methylacetamide |
|---|---|
| PubChem CID | 177234095 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | N-[(E)-2,3-dimethylbut-1-enyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)/C=C(\C)C(C)C |
| InChI | InChI=1S/C9H17NO/c1-7(2)8(3)6-10(5)9(4)11/h6-7H,1-5H3/b8-6+ |
| InChIKey | ZLHZCXGLEQZKQM-SOFGYWHQSA-N |
| XLogP | 2.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |