C12H18N2 — CID 170110414
N-[(E)-2,3-dimethylbut-1-enyl]-N'-ethenyl-N-methylprop-2-ynimidamide (PubChem CID 170110414) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is N-[(E)-2,3-dimethylbut-1-enyl]-N'-ethenyl-N-methylprop-2-ynimidamide.
| Compound Name | N-[(E)-2,3-dimethylbut-1-enyl]-N'-ethenyl-N-methylprop-2-ynimidamide |
|---|---|
| PubChem CID | 170110414 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | N-[(E)-2,3-dimethylbut-1-enyl]-N'-ethenyl-N-methylprop-2-ynimidamide |
| SMILES | C#C/C(=N\C=C)N(C)/C=C(\C)C(C)C |
| InChI | InChI=1S/C12H18N2/c1-7-12(13-8-2)14(6)9-11(5)10(3)4/h1,8-10H,2H2,3-6H3/b11-9+,13-12+ |
| InChIKey | JOYDZOSGQXJNLT-GNDASISDSA-N |
| XLogP | 2.65 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|