C13H20 — CID 59644089
(6Z,8S)-3,8-dimethylundeca-1,2,6,10-tetraene (PubChem CID 59644089) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is (6Z,8S)-3,8-dimethylundeca-1,2,6,10-tetraene.
| Compound Name | (6Z,8S)-3,8-dimethylundeca-1,2,6,10-tetraene |
|---|---|
| PubChem CID | 59644089 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | (6Z,8S)-3,8-dimethylundeca-1,2,6,10-tetraene |
| SMILES | C=C=C(C)CC/C=C\[C@@H](C)CC=C |
| InChI | InChI=1S/C13H20/c1-5-9-13(4)11-8-7-10-12(3)6-2/h5,8,11,13H,1-2,7,9-10H2,3-4H3/b11-8-/t13-/m0/s1 |
| InChIKey | DQQYCOOVCBXRLV-ZWXCPPHNSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|