About (2R)-2-methylpent-4-enal;(2S)-2-methylpent-4-enal
(2R)-2-methylpent-4-enal;(2S)-2-methylpent-4-enal (PubChem CID 159356826) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is (2R)-2-methylpent-4-enal;(2S)-2-methylpent-4-enal.
Molecular Properties
| Compound Name | (2R)-2-methylpent-4-enal;(2S)-2-methylpent-4-enal |
| PubChem CID | 159356826 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (2R)-2-methylpent-4-enal;(2S)-2-methylpent-4-enal |
| SMILES | C=CCC(C)C=O.C=CC[C@H](C)C=O |
| InChI | InChI=1S/2C6H10O/c2*1-3-4-6(2)5-7/h2*3,5-6H,1,4H2,2H3/t6-;/m0./s1 |
| InChIKey | LIAKDIZTBDCYDM-RGMNGODLSA-N |
| XLogP | 2.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-methylpent-4-enal;(2S)-2-methylpent-4-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-methylpent-4-enal;(2S)-2-methylpent-4-enal?
The IUPAC name of (2R)-2-methylpent-4-enal;(2S)-2-methylpent-4-enal (CID 159356826) is (2R)-2-methylpent-4-enal;(2S)-2-methylpent-4-enal.
What is the SMILES notation for (2R)-2-methylpent-4-enal;(2S)-2-methylpent-4-enal?
The canonical SMILES for (2R)-2-methylpent-4-enal;(2S)-2-methylpent-4-enal is C=CCC(C)C=O.C=CC[C@H](C)C=O.
What is the InChIKey of (2R)-2-methylpent-4-enal;(2S)-2-methylpent-4-enal?
The InChIKey is LIAKDIZTBDCYDM-RGMNGODLSA-N. The full InChI is InChI=1S/2C6H10O/c2*1-3-4-6(2)5-7/h2*3,5-6H,1,4H2,2H3/t6-;/m0./s1.
What are the key properties of (2R)-2-methylpent-4-enal;(2S)-2-methylpent-4-enal?
(2R)-2-methylpent-4-enal;(2S)-2-methylpent-4-enal has a molecular weight of 196.29 g/mol, XLogP of 2.80, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methylpent-4-enal;(2S)-2-methylpent-4-enal is sourced from PubChem (CID 159356826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).