About 4-imino-2-methylbutanal
4-imino-2-methylbutanal (PubChem CID 148810573) has the molecular formula C5H9NO
and a molecular weight of 99.13 g/mol. Its IUPAC name is 4-imino-2-methylbutanal.
Molecular Properties
| Compound Name | 4-imino-2-methylbutanal |
| PubChem CID | 148810573 |
| Molecular Formula | C5H9NO |
| Molecular Weight | 99.13 g/mol |
| Exact Mass | 99.07 |
| IUPAC Name | 4-imino-2-methylbutanal |
| SMILES | [H]/N=C/CC(C)C=O |
| InChI | InChI=1S/C5H9NO/c1-5(4-7)2-3-6/h3-6H,2H2,1H3/b6-3+ |
| InChIKey | XPWHSMGGMYHRCQ-ZZXKWVIFSA-N |
| XLogP | 0.86 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.13 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-imino-2-methylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imino-2-methylbutanal?
The IUPAC name of 4-imino-2-methylbutanal (CID 148810573) is 4-imino-2-methylbutanal.
What is the SMILES notation for 4-imino-2-methylbutanal?
The canonical SMILES for 4-imino-2-methylbutanal is [H]/N=C/CC(C)C=O.
What is the InChIKey of 4-imino-2-methylbutanal?
The InChIKey is XPWHSMGGMYHRCQ-ZZXKWVIFSA-N. The full InChI is InChI=1S/C5H9NO/c1-5(4-7)2-3-6/h3-6H,2H2,1H3/b6-3+.
What are the key properties of 4-imino-2-methylbutanal?
4-imino-2-methylbutanal has a molecular weight of 99.13 g/mol, XLogP of 0.86, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imino-2-methylbutanal is sourced from PubChem (CID 148810573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).