About 3,6-dimethylheptan-1-imine
3,6-dimethylheptan-1-imine (PubChem CID 175257042) has the molecular formula C9H19N
and a molecular weight of 141.26 g/mol. Its IUPAC name is 3,6-dimethylheptan-1-imine.
Molecular Properties
| Compound Name | 3,6-dimethylheptan-1-imine |
| PubChem CID | 175257042 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 3,6-dimethylheptan-1-imine |
| SMILES | [H]/N=C/CC(C)CCC(C)C |
| InChI | InChI=1S/C9H19N/c1-8(2)4-5-9(3)6-7-10/h7-10H,4-6H2,1-3H3/b10-7+ |
| InChIKey | XIAQJRXBSQUSKM-JXMROGBWSA-N |
| XLogP | 3.10 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dimethylheptan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethylheptan-1-imine?
The IUPAC name of 3,6-dimethylheptan-1-imine (CID 175257042) is 3,6-dimethylheptan-1-imine.
What is the SMILES notation for 3,6-dimethylheptan-1-imine?
The canonical SMILES for 3,6-dimethylheptan-1-imine is [H]/N=C/CC(C)CCC(C)C.
What is the InChIKey of 3,6-dimethylheptan-1-imine?
The InChIKey is XIAQJRXBSQUSKM-JXMROGBWSA-N. The full InChI is InChI=1S/C9H19N/c1-8(2)4-5-9(3)6-7-10/h7-10H,4-6H2,1-3H3/b10-7+.
What are the key properties of 3,6-dimethylheptan-1-imine?
3,6-dimethylheptan-1-imine has a molecular weight of 141.26 g/mol, XLogP of 3.10, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethylheptan-1-imine is sourced from PubChem (CID 175257042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).