About 3-iminopropane-1,1-diamine
3-iminopropane-1,1-diamine (PubChem CID 123272207) has the molecular formula C3H9N3
and a molecular weight of 87.13 g/mol. Its IUPAC name is 3-iminopropane-1,1-diamine.
Molecular Properties
| Compound Name | 3-iminopropane-1,1-diamine |
| PubChem CID | 123272207 |
| Molecular Formula | C3H9N3 |
| Molecular Weight | 87.13 g/mol |
| Exact Mass | 87.08 |
| IUPAC Name | 3-iminopropane-1,1-diamine |
| SMILES | [H]/N=C/CC(N)N |
| InChI | InChI=1S/C3H9N3/c4-2-1-3(5)6/h2-4H,1,5-6H2/b4-2+ |
| InChIKey | UEVHAXHIVGWLFH-DUXPYHPUSA-N |
| XLogP | -0.73 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.13 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-iminopropane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iminopropane-1,1-diamine?
The IUPAC name of 3-iminopropane-1,1-diamine (CID 123272207) is 3-iminopropane-1,1-diamine.
What is the SMILES notation for 3-iminopropane-1,1-diamine?
The canonical SMILES for 3-iminopropane-1,1-diamine is [H]/N=C/CC(N)N.
What is the InChIKey of 3-iminopropane-1,1-diamine?
The InChIKey is UEVHAXHIVGWLFH-DUXPYHPUSA-N. The full InChI is InChI=1S/C3H9N3/c4-2-1-3(5)6/h2-4H,1,5-6H2/b4-2+.
What are the key properties of 3-iminopropane-1,1-diamine?
3-iminopropane-1,1-diamine has a molecular weight of 87.13 g/mol, XLogP of -0.73, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iminopropane-1,1-diamine is sourced from PubChem (CID 123272207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).