C8H16N2 — CID 139852006
4-methylheptane-1,7-diimine (PubChem CID 139852006) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 4-methylheptane-1,7-diimine.
| Compound Name | 4-methylheptane-1,7-diimine |
|---|---|
| PubChem CID | 139852006 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 4-methylheptane-1,7-diimine |
| SMILES | [H]/N=C/CCC(C)CC/C=N/[H] |
| InChI | InChI=1S/C8H16N2/c1-8(4-2-6-9)5-3-7-10/h6-10H,2-5H2,1H3/b9-6+,10-7+ |
| InChIKey | POFILXIFDMDAKT-KZZDLZNXSA-N |
| XLogP | 2.48 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|