C7H13FN2O — CID 174601107
(2S)-N-(2-fluoroethyl)-4-imino-2-methylbutanamide (PubChem CID 174601107) has the molecular formula C7H13FN2O and a molecular weight of 160.19 g/mol. Its IUPAC name is (2S)-N-(2-fluoroethyl)-4-imino-2-methylbutanamide.
| Compound Name | (2S)-N-(2-fluoroethyl)-4-imino-2-methylbutanamide |
|---|---|
| PubChem CID | 174601107 |
| Molecular Formula | C7H13FN2O |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | (2S)-N-(2-fluoroethyl)-4-imino-2-methylbutanamide |
| SMILES | [H]/N=C/C[C@H](C)C(=O)NCCF |
| InChI | InChI=1S/C7H13FN2O/c1-6(2-4-9)7(11)10-5-3-8/h4,6,9H,2-3,5H2,1H3,(H,10,11)/b9-4+/t6-/m0/s1 |
| InChIKey | LBWVVECGRJUVHZ-UYHMVEIHSA-N |
| XLogP | 0.75 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|